C22H32N5O2+ — CID 143820296
ethenyl-[3-[4-[4-hydroxy-2-(2-hydroxyethylamino)-5-methylanilino]anilino]propyl]-(methylaminomethylidene)azanium (PubChem CID 143820296) has the molecular formula C22H32N5O2+ and a molecular weight of 398.53 g/mol. Its IUPAC name is ethenyl-[3-[4-[4-hydroxy-2-(2-hydroxyethylamino)-5-methylanilino]anilino]propyl]-(methylaminomethylidene)azanium.
| Compound Name | ethenyl-[3-[4-[4-hydroxy-2-(2-hydroxyethylamino)-5-methylanilino]anilino]propyl]-(methylaminomethylidene)azanium |
|---|---|
| PubChem CID | 143820296 |
| Molecular Formula | C22H32N5O2+ |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | ethenyl-[3-[4-[4-hydroxy-2-(2-hydroxyethylamino)-5-methylanilino]anilino]propyl]-(methylaminomethylidene)azanium |
| SMILES | C=C/[N+](=C\NC)CCCNc1ccc(Nc2cc(C)c(O)cc2NCCO)cc1 |
| InChI | InChI=1S/C22H31N5O2/c1-4-27(16-23-3)12-5-10-24-18-6-8-19(9-7-18)26-21-14-17(2)22(29)15-20(21)25-11-13-28/h4,6-9,14-16,24-26,28-29H,1,5,10-13H2,2-3H3/p+1 |
| InChIKey | BPEOWUQLDORBKB-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|