C30H45N6O2+ — CID 143820250
3-[4-[5-[4-[3-(dimethylamino)propylamino]anilino]-2,4-dihydroxy-3-methylanilino]anilino]propyl-trimethylazanium (PubChem CID 143820250) has the molecular formula C30H45N6O2+ and a molecular weight of 521.73 g/mol. Its IUPAC name is 3-[4-[5-[4-[3-(dimethylamino)propylamino]anilino]-2,4-dihydroxy-3-methylanilino]anilino]propyl-trimethylazanium.
| Compound Name | 3-[4-[5-[4-[3-(dimethylamino)propylamino]anilino]-2,4-dihydroxy-3-methylanilino]anilino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 143820250 |
| Molecular Formula | C30H45N6O2+ |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.36 |
| IUPAC Name | 3-[4-[5-[4-[3-(dimethylamino)propylamino]anilino]-2,4-dihydroxy-3-methylanilino]anilino]propyl-trimethylazanium |
| SMILES | Cc1c(O)c(Nc2ccc(NCCCN(C)C)cc2)cc(Nc2ccc(NCCC[N+](C)(C)C)cc2)c1O |
| InChI | InChI=1S/C30H44N6O2/c1-22-29(37)27(33-25-13-9-23(10-14-25)31-17-7-19-35(2)3)21-28(30(22)38)34-26-15-11-24(12-16-26)32-18-8-20-36(4,5)6/h9-16,21,31-34H,7-8,17-20H2,1-6H3,(H-,37,38)/p+1 |
| InChIKey | DKZKMQMBVIMXMX-UHFFFAOYSA-O |
| XLogP | 5.77 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|