C42H74N8O2+4 — CID 143820234
3-[4-[5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-2,4-dihydroxy-3-methylanilino]-N-[3-(dimethylazaniumyl)propyl]anilino]propyl-trimethylazanium (PubChem CID 143820234) has the molecular formula C42H74N8O2+4 and a molecular weight of 723.11 g/mol. Its IUPAC name is 3-[4-[5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-2,4-dihydroxy-3-methylanilino]-N-[3-(dimethylazaniumyl)propyl]anilino]propyl-trimethylazanium.
| Compound Name | 3-[4-[5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-2,4-dihydroxy-3-methylanilino]-N-[3-(dimethylazaniumyl)propyl]anilino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 143820234 |
| Molecular Formula | C42H74N8O2+4 |
| Molecular Weight | 723.11 g/mol |
| Exact Mass | 722.59 |
| IUPAC Name | 3-[4-[5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-2,4-dihydroxy-3-methylanilino]-N-[3-(dimethylazaniumyl)propyl]anilino]propyl-trimethylazanium |
| SMILES | Cc1c(O)c(Nc2ccc(N(CCC[NH+](C)C)CCC[N+](C)(C)C)cc2)cc(Nc2ccc(N(CCC[N+](C)(C)C)CCC[N+](C)(C)C)cc2)c1O |
| InChI | InChI=1S/C42H71N8O2/c1-34-41(51)39(43-35-17-21-37(22-18-35)46(26-13-25-45(2)3)27-14-30-48(4,5)6)33-40(42(34)52)44-36-19-23-38(24-20-36)47(28-15-31-49(7,8)9)29-16-32-50(10,11)12/h17-24,33,43-44H,13-16,25-32H2,1-12H3/q+1/p+3 |
| InChIKey | ZEJCVXOOLKHZFY-UHFFFAOYSA-Q |
| XLogP | 5.33 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.11 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|