C24H33N3O2 — CID 123388450
4-(4-aminoanilino)-6-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diol;ethane (PubChem CID 123388450) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-(4-aminoanilino)-6-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diol;ethane.
| Compound Name | 4-(4-aminoanilino)-6-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diol;ethane |
|---|---|
| PubChem CID | 123388450 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 4-(4-aminoanilino)-6-[(4-aminophenyl)methyl]-2-methylbenzene-1,3-diol;ethane |
| SMILES | CC.CC.Cc1c(O)c(Cc2ccc(N)cc2)cc(Nc2ccc(N)cc2)c1O |
| InChI | InChI=1S/C20H21N3O2.2C2H6/c1-12-19(24)14(10-13-2-4-15(21)5-3-13)11-18(20(12)25)23-17-8-6-16(22)7-9-17;2*1-2/h2-9,11,23-25H,10,21-22H2,1H3;2*1-2H3 |
| InChIKey | SKJHKOXEPKHTHV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|