C23H36N4O — CID 88913425
2,3-diamino-4-[4-(dipentylamino)anilino]-6-methylphenol (PubChem CID 88913425) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 2,3-diamino-4-[4-(dipentylamino)anilino]-6-methylphenol.
| Compound Name | 2,3-diamino-4-[4-(dipentylamino)anilino]-6-methylphenol |
|---|---|
| PubChem CID | 88913425 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2,3-diamino-4-[4-(dipentylamino)anilino]-6-methylphenol |
| SMILES | CCCCCN(CCCCC)c1ccc(Nc2cc(C)c(O)c(N)c2N)cc1 |
| InChI | InChI=1S/C23H36N4O/c1-4-6-8-14-27(15-9-7-5-2)19-12-10-18(11-13-19)26-20-16-17(3)23(28)22(25)21(20)24/h10-13,16,26,28H,4-9,14-15,24-25H2,1-3H3 |
| InChIKey | KMYJRPFFQUJFIH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|