C35H59N3O2 — CID 139625839
1-N-[4-[bis(1-butoxyethyl)amino]phenyl]-2-methyl-4-N,4-N-dipentylbenzene-1,4-diamine (PubChem CID 139625839) has the molecular formula C35H59N3O2 and a molecular weight of 553.88 g/mol. Its IUPAC name is 1-N-[4-[bis(1-butoxyethyl)amino]phenyl]-2-methyl-4-N,4-N-dipentylbenzene-1,4-diamine.
| Compound Name | 1-N-[4-[bis(1-butoxyethyl)amino]phenyl]-2-methyl-4-N,4-N-dipentylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 139625839 |
| Molecular Formula | C35H59N3O2 |
| Molecular Weight | 553.88 g/mol |
| Exact Mass | 553.46 |
| IUPAC Name | 1-N-[4-[bis(1-butoxyethyl)amino]phenyl]-2-methyl-4-N,4-N-dipentylbenzene-1,4-diamine |
| SMILES | CCCCCN(CCCCC)c1ccc(Nc2ccc(N(C(C)OCCCC)C(C)OCCCC)cc2)c(C)c1 |
| InChI | InChI=1S/C35H59N3O2/c1-8-12-16-24-37(25-17-13-9-2)34-22-23-35(29(5)28-34)36-32-18-20-33(21-19-32)38(30(6)39-26-14-10-3)31(7)40-27-15-11-4/h18-23,28,30-31,36H,8-17,24-27H2,1-7H3 |
| InChIKey | QYMAWLVFPUQLLT-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.88 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|