C18H31BrN2 — CID 150613789
2-bromo-4-N,4-N-dihexylbenzene-1,4-diamine (PubChem CID 150613789) has the molecular formula C18H31BrN2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-bromo-4-N,4-N-dihexylbenzene-1,4-diamine.
| Compound Name | 2-bromo-4-N,4-N-dihexylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 150613789 |
| Molecular Formula | C18H31BrN2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-bromo-4-N,4-N-dihexylbenzene-1,4-diamine |
| SMILES | CCCCCCN(CCCCCC)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C18H31BrN2/c1-3-5-7-9-13-21(14-10-8-6-4-2)16-11-12-18(20)17(19)15-16/h11-12,15H,3-10,13-14,20H2,1-2H3 |
| InChIKey | IULPJKTYUZLROK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|