C35H38N2O4 — CID 11071702
2-[2-(4-anilino-3-methylphenoxy)-4-(dibutylamino)benzoyl]benzoic acid (PubChem CID 11071702) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-[2-(4-anilino-3-methylphenoxy)-4-(dibutylamino)benzoyl]benzoic acid.
| Compound Name | 2-[2-(4-anilino-3-methylphenoxy)-4-(dibutylamino)benzoyl]benzoic acid |
|---|---|
| PubChem CID | 11071702 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 2-[2-(4-anilino-3-methylphenoxy)-4-(dibutylamino)benzoyl]benzoic acid |
| SMILES | CCCCN(CCCC)c1ccc(C(=O)c2ccccc2C(=O)O)c(Oc2ccc(Nc3ccccc3)c(C)c2)c1 |
| InChI | InChI=1S/C35H38N2O4/c1-4-6-21-37(22-7-5-2)27-17-19-31(34(38)29-15-11-12-16-30(29)35(39)40)33(24-27)41-28-18-20-32(25(3)23-28)36-26-13-9-8-10-14-26/h8-20,23-24,36H,4-7,21-22H2,1-3H3,(H,39,40) |
| InChIKey | BPEZZUWOZFMOHL-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |