C25H38N2O — CID 18998076
N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-methoxymethyl]-3-methylaniline (PubChem CID 18998076) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-methoxymethyl]-3-methylaniline.
| Compound Name | N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-methoxymethyl]-3-methylaniline |
|---|---|
| PubChem CID | 18998076 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-methoxymethyl]-3-methylaniline |
| SMILES | CCCCN(CCCC)c1ccc(C(OC)c2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C25H38N2O/c1-7-9-17-27(18-10-8-2)23-15-16-24(20(3)19-23)25(28-6)21-11-13-22(14-12-21)26(4)5/h11-16,19,25H,7-10,17-18H2,1-6H3 |
| InChIKey | VGVHQGKVIZPIFD-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|