C36H51N3O — CID 144813879
4-[[4-(diethylamino)-2-methylphenyl]-[4-[methyl-[4-(oxiran-2-yl)butyl]amino]phenyl]methyl]-N,N-diethyl-3-methylaniline (PubChem CID 144813879) has the molecular formula C36H51N3O and a molecular weight of 541.82 g/mol. Its IUPAC name is 4-[[4-(diethylamino)-2-methylphenyl]-[4-[methyl-[4-(oxiran-2-yl)butyl]amino]phenyl]methyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[[4-(diethylamino)-2-methylphenyl]-[4-[methyl-[4-(oxiran-2-yl)butyl]amino]phenyl]methyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 144813879 |
| Molecular Formula | C36H51N3O |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.40 |
| IUPAC Name | 4-[[4-(diethylamino)-2-methylphenyl]-[4-[methyl-[4-(oxiran-2-yl)butyl]amino]phenyl]methyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(C)CCCCC3CO3)cc2)c2ccc(N(CC)CC)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H51N3O/c1-8-38(9-2)31-19-21-34(27(5)24-31)36(35-22-20-32(25-28(35)6)39(10-3)11-4)29-15-17-30(18-16-29)37(7)23-13-12-14-33-26-40-33/h15-22,24-25,33,36H,8-14,23,26H2,1-7H3 |
| InChIKey | DMDCQRJNBSBDCY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 22.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|