C33H47N3O2 — CID 59366403
2-[4-[[4-(diethylamino)phenyl]-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]ethanol (PubChem CID 59366403) has the molecular formula C33H47N3O2 and a molecular weight of 517.76 g/mol. Its IUPAC name is 2-[4-[[4-(diethylamino)phenyl]-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]ethanol.
| Compound Name | 2-[4-[[4-(diethylamino)phenyl]-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 59366403 |
| Molecular Formula | C33H47N3O2 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.37 |
| IUPAC Name | 2-[4-[[4-(diethylamino)phenyl]-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]ethanol |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CCO)cc2C)c2ccc(N(CC)CCO)cc2C)cc1 |
| InChI | InChI=1S/C33H47N3O2/c1-7-34(8-2)28-13-11-27(12-14-28)33(31-17-15-29(23-25(31)5)35(9-3)19-21-37)32-18-16-30(24-26(32)6)36(10-4)20-22-38/h11-18,23-24,33,37-38H,7-10,19-22H2,1-6H3 |
| InChIKey | FGKHUGHYPBVJAD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|