C35H43N3O4 — CID 134463394
2-[4-[(4-anilinophenyl)-[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol (PubChem CID 134463394) has the molecular formula C35H43N3O4 and a molecular weight of 569.75 g/mol. Its IUPAC name is 2-[4-[(4-anilinophenyl)-[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol.
| Compound Name | 2-[4-[(4-anilinophenyl)-[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 134463394 |
| Molecular Formula | C35H43N3O4 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | 2-[4-[(4-anilinophenyl)-[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
| SMILES | Cc1cc(N(CCO)CCO)ccc1C(c1ccc(Nc2ccccc2)cc1)c1ccc(N(CCO)CCO)cc1C |
| InChI | InChI=1S/C35H43N3O4/c1-26-24-31(37(16-20-39)17-21-40)12-14-33(26)35(28-8-10-30(11-9-28)36-29-6-4-3-5-7-29)34-15-13-32(25-27(34)2)38(18-22-41)19-23-42/h3-15,24-25,35-36,39-42H,16-23H2,1-2H3 |
| InChIKey | YOJCJZPBUPMIJX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|