C49H55N3O7S2 — CID 58434971
methyl 3-[[4-[[4-(4-ethoxyanilino)phenyl]-[4-[ethyl-[(3-methoxysulfonylphenyl)methyl]amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]methyl]benzenesulfonate (PubChem CID 58434971) has the molecular formula C49H55N3O7S2 and a molecular weight of 862.13 g/mol. Its IUPAC name is methyl 3-[[4-[[4-(4-ethoxyanilino)phenyl]-[4-[ethyl-[(3-methoxysulfonylphenyl)methyl]amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]methyl]benzenesulfonate.
| Compound Name | methyl 3-[[4-[[4-(4-ethoxyanilino)phenyl]-[4-[ethyl-[(3-methoxysulfonylphenyl)methyl]amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 58434971 |
| Molecular Formula | C49H55N3O7S2 |
| Molecular Weight | 862.13 g/mol |
| Exact Mass | 861.35 |
| IUPAC Name | methyl 3-[[4-[[4-(4-ethoxyanilino)phenyl]-[4-[ethyl-[(3-methoxysulfonylphenyl)methyl]amino]-2-methylphenyl]methyl]-N-ethyl-3-methylanilino]methyl]benzenesulfonate |
| SMILES | CCOc1ccc(Nc2ccc(C(c3ccc(N(CC)Cc4cccc(S(=O)(=O)OC)c4)cc3C)c3ccc(N(CC)Cc4cccc(S(=O)(=O)OC)c4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C49H55N3O7S2/c1-8-51(33-37-13-11-15-45(31-37)60(53,54)57-6)42-23-27-47(35(4)29-42)49(39-17-19-40(20-18-39)50-41-21-25-44(26-22-41)59-10-3)48-28-24-43(30-36(48)5)52(9-2)34-38-14-12-16-46(32-38)61(55,56)58-7/h11-32,49-50H,8-10,33-34H2,1-7H3 |
| InChIKey | OXWTUGVZYNKRFI-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.13 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|