C14H23Cl2N2O2P — CID 102057991
4-[dichlorophosphoryloxy(dimethylamino)methyl]-N,N-diethyl-3-methylaniline (PubChem CID 102057991) has the molecular formula C14H23Cl2N2O2P and a molecular weight of 353.23 g/mol. Its IUPAC name is 4-[dichlorophosphoryloxy(dimethylamino)methyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[dichlorophosphoryloxy(dimethylamino)methyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 102057991 |
| Molecular Formula | C14H23Cl2N2O2P |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-[dichlorophosphoryloxy(dimethylamino)methyl]-N,N-diethyl-3-methylaniline |
| SMILES | CCN(CC)c1ccc(C(OP(=O)(Cl)Cl)N(C)C)c(C)c1 |
| InChI | InChI=1S/C14H23Cl2N2O2P/c1-6-18(7-2)12-8-9-13(11(3)10-12)14(17(4)5)20-21(15,16)19/h8-10,14H,6-7H2,1-5H3 |
| InChIKey | BTBVTGCJKCUZHJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|