C28H44N2O — CID 139775188
4-[[4-(dipropylamino)phenyl]-propoxymethyl]-N,N-dipropylaniline (PubChem CID 139775188) has the molecular formula C28H44N2O and a molecular weight of 424.67 g/mol. Its IUPAC name is 4-[[4-(dipropylamino)phenyl]-propoxymethyl]-N,N-dipropylaniline.
| Compound Name | 4-[[4-(dipropylamino)phenyl]-propoxymethyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 139775188 |
| Molecular Formula | C28H44N2O |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | 4-[[4-(dipropylamino)phenyl]-propoxymethyl]-N,N-dipropylaniline |
| SMILES | CCCOC(c1ccc(N(CCC)CCC)cc1)c1ccc(N(CCC)CCC)cc1 |
| InChI | InChI=1S/C28H44N2O/c1-6-19-29(20-7-2)26-15-11-24(12-16-26)28(31-23-10-5)25-13-17-27(18-14-25)30(21-8-3)22-9-4/h11-18,28H,6-10,19-23H2,1-5H3 |
| InChIKey | BFZGXWTWUOJDHM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|