C44H76N2O5 — CID 139775210
4-[[4-(diheptoxyamino)phenyl]-propoxymethyl]-N,N-diheptoxyaniline (PubChem CID 139775210) has the molecular formula C44H76N2O5 and a molecular weight of 713.10 g/mol. Its IUPAC name is 4-[[4-(diheptoxyamino)phenyl]-propoxymethyl]-N,N-diheptoxyaniline.
| Compound Name | 4-[[4-(diheptoxyamino)phenyl]-propoxymethyl]-N,N-diheptoxyaniline |
|---|---|
| PubChem CID | 139775210 |
| Molecular Formula | C44H76N2O5 |
| Molecular Weight | 713.10 g/mol |
| Exact Mass | 712.58 |
| IUPAC Name | 4-[[4-(diheptoxyamino)phenyl]-propoxymethyl]-N,N-diheptoxyaniline |
| SMILES | CCCCCCCON(OCCCCCCC)c1ccc(C(OCCC)c2ccc(N(OCCCCCCC)OCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H76N2O5/c1-6-11-15-19-23-36-48-45(49-37-24-20-16-12-7-2)42-31-27-40(28-32-42)44(47-35-10-5)41-29-33-43(34-30-41)46(50-38-25-21-17-13-8-3)51-39-26-22-18-14-9-4/h27-34,44H,6-26,35-39H2,1-5H3 |
| InChIKey | KPFNCZIPIIHBRO-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.10 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|