C26H42N4 — CID 67291446
(1S,2S)-1,2-bis[4-(dipropylamino)phenyl]ethane-1,2-diamine (PubChem CID 67291446) has the molecular formula C26H42N4 and a molecular weight of 410.65 g/mol. Its IUPAC name is (1S,2S)-1,2-bis[4-(dipropylamino)phenyl]ethane-1,2-diamine.
| Compound Name | (1S,2S)-1,2-bis[4-(dipropylamino)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 67291446 |
| Molecular Formula | C26H42N4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | (1S,2S)-1,2-bis[4-(dipropylamino)phenyl]ethane-1,2-diamine |
| SMILES | CCCN(CCC)c1ccc([C@H](N)[C@@H](N)c2ccc(N(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C26H42N4/c1-5-17-29(18-6-2)23-13-9-21(10-14-23)25(27)26(28)22-11-15-24(16-12-22)30(19-7-3)20-8-4/h9-16,25-26H,5-8,17-20,27-28H2,1-4H3/t25-,26-/m0/s1 |
| InChIKey | YWQJUYNQRUZJDZ-UIOOFZCWSA-N |
| XLogP | 5.64 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|