C29H45N3O — CID 54530782
N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-pyrrolidin-1-ylmethyl]-3-ethoxyaniline (PubChem CID 54530782) has the molecular formula C29H45N3O and a molecular weight of 451.70 g/mol. Its IUPAC name is N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-pyrrolidin-1-ylmethyl]-3-ethoxyaniline.
| Compound Name | N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-pyrrolidin-1-ylmethyl]-3-ethoxyaniline |
|---|---|
| PubChem CID | 54530782 |
| Molecular Formula | C29H45N3O |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.36 |
| IUPAC Name | N,N-dibutyl-4-[[4-(dimethylamino)phenyl]-pyrrolidin-1-ylmethyl]-3-ethoxyaniline |
| SMILES | CCCCN(CCCC)c1ccc(C(c2ccc(N(C)C)cc2)N2CCCC2)c(OCC)c1 |
| InChI | InChI=1S/C29H45N3O/c1-6-9-19-31(20-10-7-2)26-17-18-27(28(23-26)33-8-3)29(32-21-11-12-22-32)24-13-15-25(16-14-24)30(4)5/h13-18,23,29H,6-12,19-22H2,1-5H3 |
| InChIKey | YWJHPOTXCJCLOK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|