C31H42N2O2 — CID 18998123
4-[[4-(dimethylamino)phenyl]-[(4-propylphenyl)methoxy]methyl]-3-ethoxy-N,N-diethylaniline (PubChem CID 18998123) has the molecular formula C31H42N2O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-[(4-propylphenyl)methoxy]methyl]-3-ethoxy-N,N-diethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-[(4-propylphenyl)methoxy]methyl]-3-ethoxy-N,N-diethylaniline |
|---|---|
| PubChem CID | 18998123 |
| Molecular Formula | C31H42N2O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-[(4-propylphenyl)methoxy]methyl]-3-ethoxy-N,N-diethylaniline |
| SMILES | CCCc1ccc(COC(c2ccc(N(C)C)cc2)c2ccc(N(CC)CC)cc2OCC)cc1 |
| InChI | InChI=1S/C31H42N2O2/c1-7-11-24-12-14-25(15-13-24)23-35-31(26-16-18-27(19-17-26)32(5)6)29-21-20-28(33(8-2)9-3)22-30(29)34-10-4/h12-22,31H,7-11,23H2,1-6H3 |
| InChIKey | PAOVKNODYSIMPK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|