C29H38N4O2 — CID 54257011
[2-[bis[4-(dimethylamino)phenyl]methyl]-5-(diethylamino)phenyl] N-methylcarbamate (PubChem CID 54257011) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is [2-[bis[4-(dimethylamino)phenyl]methyl]-5-(diethylamino)phenyl] N-methylcarbamate.
| Compound Name | [2-[bis[4-(dimethylamino)phenyl]methyl]-5-(diethylamino)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 54257011 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [2-[bis[4-(dimethylamino)phenyl]methyl]-5-(diethylamino)phenyl] N-methylcarbamate |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)c(OC(=O)NC)c1 |
| InChI | InChI=1S/C29H38N4O2/c1-8-33(9-2)25-18-19-26(27(20-25)35-29(34)30-3)28(21-10-14-23(15-11-21)31(4)5)22-12-16-24(17-13-22)32(6)7/h10-20,28H,8-9H2,1-7H3,(H,30,34) |
| InChIKey | RATZCHDWKWZASC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|