C51H50N4O2 — CID 172723682
[2-[bis[4-(dibenzylamino)phenyl]methyl]-5-(dimethylamino)phenyl] N-methylcarbamate (PubChem CID 172723682) has the molecular formula C51H50N4O2 and a molecular weight of 750.99 g/mol. Its IUPAC name is [2-[bis[4-(dibenzylamino)phenyl]methyl]-5-(dimethylamino)phenyl] N-methylcarbamate.
| Compound Name | [2-[bis[4-(dibenzylamino)phenyl]methyl]-5-(dimethylamino)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 172723682 |
| Molecular Formula | C51H50N4O2 |
| Molecular Weight | 750.99 g/mol |
| Exact Mass | 750.39 |
| IUPAC Name | [2-[bis[4-(dibenzylamino)phenyl]methyl]-5-(dimethylamino)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(N(C)C)ccc1C(c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1)c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C51H50N4O2/c1-52-51(56)57-49-34-47(53(2)3)32-33-48(49)50(43-24-28-45(29-25-43)54(35-39-16-8-4-9-17-39)36-40-18-10-5-11-19-40)44-26-30-46(31-27-44)55(37-41-20-12-6-13-21-41)38-42-22-14-7-15-23-42/h4-34,50H,35-38H2,1-3H3,(H,52,56) |
| InChIKey | GVYHIPNCSRUEJY-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.99 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|