C28H35N3O2 — CID 70188123
2-[bis[4-(propylamino)phenyl]methyl]-5-(dimethylamino)benzoic acid (PubChem CID 70188123) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 2-[bis[4-(propylamino)phenyl]methyl]-5-(dimethylamino)benzoic acid.
| Compound Name | 2-[bis[4-(propylamino)phenyl]methyl]-5-(dimethylamino)benzoic acid |
|---|---|
| PubChem CID | 70188123 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 2-[bis[4-(propylamino)phenyl]methyl]-5-(dimethylamino)benzoic acid |
| SMILES | CCCNc1ccc(C(c2ccc(NCCC)cc2)c2ccc(N(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C28H35N3O2/c1-5-17-29-22-11-7-20(8-12-22)27(21-9-13-23(14-10-21)30-18-6-2)25-16-15-24(31(3)4)19-26(25)28(32)33/h7-16,19,27,29-30H,5-6,17-18H2,1-4H3,(H,32,33) |
| InChIKey | AVJUNKFHJKXZCJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|