C29H35N3O2 — CID 144813887
2-[4-[bis[4-(dimethylamino)phenyl]methyl]anilino]ethyl 2-methylprop-2-enoate (PubChem CID 144813887) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 2-[4-[bis[4-(dimethylamino)phenyl]methyl]anilino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[bis[4-(dimethylamino)phenyl]methyl]anilino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144813887 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 2-[4-[bis[4-(dimethylamino)phenyl]methyl]anilino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNc1ccc(C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O2/c1-21(2)29(33)34-20-19-30-25-13-7-22(8-14-25)28(23-9-15-26(16-10-23)31(3)4)24-11-17-27(18-12-24)32(5)6/h7-18,28,30H,1,19-20H2,2-6H3 |
| InChIKey | HLTCACMKUWIBIG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|