C27H35N3O — CID 139644957
4-[[4-(dimethylamino)phenyl]-(2-methylanilino)methyl]-N,N-diethyl-3-methoxyaniline (PubChem CID 139644957) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-(2-methylanilino)methyl]-N,N-diethyl-3-methoxyaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-(2-methylanilino)methyl]-N,N-diethyl-3-methoxyaniline |
|---|---|
| PubChem CID | 139644957 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-(2-methylanilino)methyl]-N,N-diethyl-3-methoxyaniline |
| SMILES | CCN(CC)c1ccc(C(Nc2ccccc2C)c2ccc(N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H35N3O/c1-7-30(8-2)23-17-18-24(26(19-23)31-6)27(28-25-12-10-9-11-20(25)3)21-13-15-22(16-14-21)29(4)5/h9-19,27-28H,7-8H2,1-6H3 |
| InChIKey | YGHIYLFWLZIMFW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|