C30H41N3O — CID 139618070
4-[bis[4-(diethylamino)phenyl]methyl]-3-methoxy-N,N-dimethylaniline (PubChem CID 139618070) has the molecular formula C30H41N3O and a molecular weight of 459.68 g/mol. Its IUPAC name is 4-[bis[4-(diethylamino)phenyl]methyl]-3-methoxy-N,N-dimethylaniline.
| Compound Name | 4-[bis[4-(diethylamino)phenyl]methyl]-3-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139618070 |
| Molecular Formula | C30H41N3O |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 4-[bis[4-(diethylamino)phenyl]methyl]-3-methoxy-N,N-dimethylaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)c2ccc(N(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C30H41N3O/c1-8-32(9-2)25-16-12-23(13-17-25)30(24-14-18-26(19-15-24)33(10-3)11-4)28-21-20-27(31(5)6)22-29(28)34-7/h12-22,30H,8-11H2,1-7H3 |
| InChIKey | FHXFNYBXXXPUHQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|