C34H49N3O — CID 139618074
4-[bis[4-(diethylamino)phenyl]methyl]-N,N-diethyl-3-propan-2-yloxyaniline (PubChem CID 139618074) has the molecular formula C34H49N3O and a molecular weight of 515.79 g/mol. Its IUPAC name is 4-[bis[4-(diethylamino)phenyl]methyl]-N,N-diethyl-3-propan-2-yloxyaniline.
| Compound Name | 4-[bis[4-(diethylamino)phenyl]methyl]-N,N-diethyl-3-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 139618074 |
| Molecular Formula | C34H49N3O |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 515.39 |
| IUPAC Name | 4-[bis[4-(diethylamino)phenyl]methyl]-N,N-diethyl-3-propan-2-yloxyaniline |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2OC(C)C)cc1 |
| InChI | InChI=1S/C34H49N3O/c1-9-35(10-2)29-19-15-27(16-20-29)34(28-17-21-30(22-18-28)36(11-3)12-4)32-24-23-31(37(13-5)14-6)25-33(32)38-26(7)8/h15-26,34H,9-14H2,1-8H3 |
| InChIKey | ZMEYYPXYTYCOQE-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|