C28H36N2S2 — CID 145436804
2-[[4-(diethylamino)phenyl]-[4-[ethyl(propan-2-yl)amino]phenyl]methyl]benzene-1,4-dithiol (PubChem CID 145436804) has the molecular formula C28H36N2S2 and a molecular weight of 464.74 g/mol. Its IUPAC name is 2-[[4-(diethylamino)phenyl]-[4-[ethyl(propan-2-yl)amino]phenyl]methyl]benzene-1,4-dithiol.
| Compound Name | 2-[[4-(diethylamino)phenyl]-[4-[ethyl(propan-2-yl)amino]phenyl]methyl]benzene-1,4-dithiol |
|---|---|
| PubChem CID | 145436804 |
| Molecular Formula | C28H36N2S2 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-[[4-(diethylamino)phenyl]-[4-[ethyl(propan-2-yl)amino]phenyl]methyl]benzene-1,4-dithiol |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)C(C)C)cc2)c2cc(S)ccc2S)cc1 |
| InChI | InChI=1S/C28H36N2S2/c1-6-29(7-2)23-13-9-21(10-14-23)28(26-19-25(31)17-18-27(26)32)22-11-15-24(16-12-22)30(8-3)20(4)5/h9-20,28,31-32H,6-8H2,1-5H3 |
| InChIKey | PYMAKWCZZGZQPI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|