C25H30N2O2 — CID 154413110
4-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)methoxy]methyl]-N,N-dimethylaniline (PubChem CID 154413110) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)methoxy]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)methoxy]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154413110 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-[(4-methoxyphenyl)methoxy]methyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(COC(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O2/c1-26(2)22-12-8-20(9-13-22)25(21-10-14-23(15-11-21)27(3)4)29-18-19-6-16-24(28-5)17-7-19/h6-17,25H,18H2,1-5H3 |
| InChIKey | JAQYFQBLBAJQAE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|