C29H34N2O2 — CID 177406918
(Z,4R)-5,5-bis[4-(dimethylamino)phenyl]-4-(4-methoxyphenyl)-2-methylpent-2-enal (PubChem CID 177406918) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is (Z,4R)-5,5-bis[4-(dimethylamino)phenyl]-4-(4-methoxyphenyl)-2-methylpent-2-enal.
| Compound Name | (Z,4R)-5,5-bis[4-(dimethylamino)phenyl]-4-(4-methoxyphenyl)-2-methylpent-2-enal |
|---|---|
| PubChem CID | 177406918 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (Z,4R)-5,5-bis[4-(dimethylamino)phenyl]-4-(4-methoxyphenyl)-2-methylpent-2-enal |
| SMILES | COc1ccc([C@H](/C=C(/C)C=O)C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-21(20-32)19-28(22-11-17-27(33-6)18-12-22)29(23-7-13-25(14-8-23)30(2)3)24-9-15-26(16-10-24)31(4)5/h7-20,28-29H,1-6H3/b21-19-/t28-/m0/s1 |
| InChIKey | SNCMFIVSAWCVHS-WMVCGJOFSA-N |
| XLogP | 5.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|