C21H30N2O — CID 18998131
4-[[4-(dimethylamino)phenyl]-methoxymethyl]-N,N-dimethyl-3-propylaniline (PubChem CID 18998131) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-methoxymethyl]-N,N-dimethyl-3-propylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-methoxymethyl]-N,N-dimethyl-3-propylaniline |
|---|---|
| PubChem CID | 18998131 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-methoxymethyl]-N,N-dimethyl-3-propylaniline |
| SMILES | CCCc1cc(N(C)C)ccc1C(OC)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H30N2O/c1-7-8-17-15-19(23(4)5)13-14-20(17)21(24-6)16-9-11-18(12-10-16)22(2)3/h9-15,21H,7-8H2,1-6H3 |
| InChIKey | SMRQXGBOFVTDGK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|