C41H72N10O+4 — CID 58150882
3-[4-[[6-amino-3-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-5-oxo-2-pyridinylidene]amino]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium (PubChem CID 58150882) has the molecular formula C41H72N10O+4 and a molecular weight of 721.10 g/mol. Its IUPAC name is 3-[4-[[6-amino-3-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-5-oxo-2-pyridinylidene]amino]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium.
| Compound Name | 3-[4-[[6-amino-3-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-5-oxo-2-pyridinylidene]amino]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58150882 |
| Molecular Formula | C41H72N10O+4 |
| Molecular Weight | 721.10 g/mol |
| Exact Mass | 720.59 |
| IUPAC Name | 3-[4-[[6-amino-3-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-5-oxo-2-pyridinylidene]amino]-N-[3-(trimethylazaniumyl)propyl]anilino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN(CCC[N+](C)(C)C)c1ccc(/N=C2\N=C(N)C(=O)C=C2Nc2ccc(N(CCC[N+](C)(C)C)CCC[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C41H71N10O/c1-48(2,3)29-13-25-46(26-14-30-49(4,5)6)36-21-17-34(18-22-36)43-38-33-39(52)40(42)45-41(38)44-35-19-23-37(24-20-35)47(27-15-31-50(7,8)9)28-16-32-51(10,11)12/h17-24,33H,13-16,25-32H2,1-12H3,(H2-,42,43,44,45,52)/q+3/p+1 |
| InChIKey | QFNRJISUSCBFCX-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.10 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|