C30H43N7O — CID 70820288
5-amino-2-[4-[2-(diethylamino)ethylamino]anilino]-4-[4-[2-(diethylamino)ethylamino]phenyl]iminocyclohexa-2,5-dien-1-one (PubChem CID 70820288) has the molecular formula C30H43N7O and a molecular weight of 517.72 g/mol. Its IUPAC name is 5-amino-2-[4-[2-(diethylamino)ethylamino]anilino]-4-[4-[2-(diethylamino)ethylamino]phenyl]iminocyclohexa-2,5-dien-1-one.
| Compound Name | 5-amino-2-[4-[2-(diethylamino)ethylamino]anilino]-4-[4-[2-(diethylamino)ethylamino]phenyl]iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 70820288 |
| Molecular Formula | C30H43N7O |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | 5-amino-2-[4-[2-(diethylamino)ethylamino]anilino]-4-[4-[2-(diethylamino)ethylamino]phenyl]iminocyclohexa-2,5-dien-1-one |
| SMILES | CCN(CC)CCNc1ccc(/N=C2\C=C(Nc3ccc(NCCN(CC)CC)cc3)C(=O)C=C2N)cc1 |
| InChI | InChI=1S/C30H43N7O/c1-5-36(6-2)19-17-32-23-9-13-25(14-10-23)34-28-22-29(30(38)21-27(28)31)35-26-15-11-24(12-16-26)33-18-20-37(7-3)8-4/h9-16,21-22,32-33,35H,5-8,17-20,31H2,1-4H3/b34-28+ |
| InChIKey | JLIDRKPKKJQBSP-CDSHQWRTSA-N |
| XLogP | 4.69 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|