C32H43N8O+ — CID 175698987
[1-[4-[[2-amino-5-[4-[3-(3-methyl-2H-imidazol-1-yl)propylamino]anilino]-4-oxocyclohexa-2,5-dien-1-ylidene]amino]phenyl]pyrrolidin-3-yl]-trimethylazanium (PubChem CID 175698987) has the molecular formula C32H43N8O+ and a molecular weight of 555.75 g/mol. Its IUPAC name is [1-[4-[[2-amino-5-[4-[3-(3-methyl-2H-imidazol-1-yl)propylamino]anilino]-4-oxocyclohexa-2,5-dien-1-ylidene]amino]phenyl]pyrrolidin-3-yl]-trimethylazanium.
| Compound Name | [1-[4-[[2-amino-5-[4-[3-(3-methyl-2H-imidazol-1-yl)propylamino]anilino]-4-oxocyclohexa-2,5-dien-1-ylidene]amino]phenyl]pyrrolidin-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 175698987 |
| Molecular Formula | C32H43N8O+ |
| Molecular Weight | 555.75 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | [1-[4-[[2-amino-5-[4-[3-(3-methyl-2H-imidazol-1-yl)propylamino]anilino]-4-oxocyclohexa-2,5-dien-1-ylidene]amino]phenyl]pyrrolidin-3-yl]-trimethylazanium |
| SMILES | CN1C=CN(CCCNc2ccc(NC3=C/C(=N\c4ccc(N5CCC([N+](C)(C)C)C5)cc4)C(N)=CC3=O)cc2)C1 |
| InChI | InChI=1S/C32H42N8O/c1-37-18-19-38(23-37)16-5-15-34-24-6-8-25(9-7-24)36-31-21-30(29(33)20-32(31)41)35-26-10-12-27(13-11-26)39-17-14-28(22-39)40(2,3)4/h6-13,18-21,28H,5,14-17,22-23H2,1-4H3,(H3-,33,34,35,36,41)/p+1 |
| InChIKey | QJYCAWVFCVJDOW-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|