C35H63IN6+2 — CID 173087981
[1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-pentylazanium;[1-(4-aminophenyl)pyrrolidin-3-yl]-hexyl-dimethylazanium;hydroiodide (PubChem CID 173087981) has the molecular formula C35H63IN6+2 and a molecular weight of 694.84 g/mol. Its IUPAC name is [1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-pentylazanium;[1-(4-aminophenyl)pyrrolidin-3-yl]-hexyl-dimethylazanium;hydroiodide.
| Compound Name | [1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-pentylazanium;[1-(4-aminophenyl)pyrrolidin-3-yl]-hexyl-dimethylazanium;hydroiodide |
|---|---|
| PubChem CID | 173087981 |
| Molecular Formula | C35H63IN6+2 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.41 |
| IUPAC Name | [1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-pentylazanium;[1-(4-aminophenyl)pyrrolidin-3-yl]-hexyl-dimethylazanium;hydroiodide |
| SMILES | CCCCCC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.CCCCC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.I |
| InChI | InChI=1S/C18H32N3.C17H30N3.HI/c1-4-5-6-7-14-21(2,3)18-12-13-20(15-18)17-10-8-16(19)9-11-17;1-4-5-6-13-20(2,3)17-11-12-19(14-17)16-9-7-15(18)8-10-16;/h8-11,18H,4-7,12-15,19H2,1-3H3;7-10,17H,4-6,11-14,18H2,1-3H3;1H/q2*+1; |
| InChIKey | BDXSIPPSXBTUMD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|