C21H40Cl2N4 — CID 173087856
(4-amino-2,3-dimethylheptan-2-yl)-[1-(4-aminophenyl)pyrrolidin-3-yl]-dimethylazanium;chloride;hydrochloride (PubChem CID 173087856) has the molecular formula C21H40Cl2N4 and a molecular weight of 419.49 g/mol. Its IUPAC name is (4-amino-2,3-dimethylheptan-2-yl)-[1-(4-aminophenyl)pyrrolidin-3-yl]-dimethylazanium;chloride;hydrochloride.
| Compound Name | (4-amino-2,3-dimethylheptan-2-yl)-[1-(4-aminophenyl)pyrrolidin-3-yl]-dimethylazanium;chloride;hydrochloride |
|---|---|
| PubChem CID | 173087856 |
| Molecular Formula | C21H40Cl2N4 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (4-amino-2,3-dimethylheptan-2-yl)-[1-(4-aminophenyl)pyrrolidin-3-yl]-dimethylazanium;chloride;hydrochloride |
| SMILES | CCCC(N)C(C)C(C)(C)[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.Cl.[Cl-] |
| InChI | InChI=1S/C21H39N4.2ClH/c1-7-8-20(23)16(2)21(3,4)25(5,6)19-13-14-24(15-19)18-11-9-17(22)10-12-18;;/h9-12,16,19-20H,7-8,13-15,22-23H2,1-6H3;2*1H/q+1;;/p-1 |
| InChIKey | WMHJLTKBMPBOFC-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|