C28H49ClN6+2 — CID 173087840
bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride (PubChem CID 173087840) has the molecular formula C28H49ClN6+2 and a molecular weight of 505.20 g/mol. Its IUPAC name is bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride.
| Compound Name | bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride |
|---|---|
| PubChem CID | 173087840 |
| Molecular Formula | C28H49ClN6+2 |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride |
| SMILES | CC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.CC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.Cl |
| InChI | InChI=1S/2C14H24N3.ClH/c2*1-4-17(2,3)14-9-10-16(11-14)13-7-5-12(15)6-8-13;/h2*5-8,14H,4,9-11,15H2,1-3H3;1H/q2*+1; |
| InChIKey | JEEDYNGXIYDBOS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|