About bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride
bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride (PubChem CID 173087840) has the molecular formula C28H49ClN6+2
and a molecular weight of 505.20 g/mol. Its IUPAC name is bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride.
Molecular Properties
| Compound Name | bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride |
| PubChem CID | 173087840 |
| Molecular Formula | C28H49ClN6+2 |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride |
| SMILES | CC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.CC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.Cl |
| InChI | InChI=1S/2C14H24N3.ClH/c2*1-4-17(2,3)14-9-10-16(11-14)13-7-5-12(15)6-8-13;/h2*5-8,14H,4,9-11,15H2,1-3H3;1H/q2*+1; |
| InChIKey | JEEDYNGXIYDBOS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride?
The IUPAC name of bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride (CID 173087840) is bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride.
What is the SMILES notation for bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride?
The canonical SMILES for bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride is CC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.CC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1.Cl.
What is the InChIKey of bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride?
The InChIKey is JEEDYNGXIYDBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H24N3.ClH/c2*1-4-17(2,3)14-9-10-16(11-14)13-7-5-12(15)6-8-13;/h2*5-8,14H,4,9-11,15H2,1-3H3;1H/q2*+1;.
What are the key properties of bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride?
bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride has a molecular weight of 505.20 g/mol, XLogP of 4.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis([1-(4-aminophenyl)pyrrolidin-3-yl]-ethyl-dimethylazanium);hydrochloride is sourced from PubChem (CID 173087840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).