C19H36N3S+ — CID 143753053
[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium (PubChem CID 143753053) has the molecular formula C19H36N3S+ and a molecular weight of 338.59 g/mol. Its IUPAC name is [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium.
| Compound Name | [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium |
|---|---|
| PubChem CID | 143753053 |
| Molecular Formula | C19H36N3S+ |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium |
| SMILES | Cc1cc(N2CCC([N+](C)(C)CCCS(C)(C)C)C2)ccc1N |
| InChI | InChI=1S/C19H36N3S/c1-16-14-17(8-9-19(16)20)21-11-10-18(15-21)22(2,3)12-7-13-23(4,5)6/h8-9,14,18H,7,10-13,15,20H2,1-6H3/q+1 |
| InChIKey | IONOVUWEACVNHX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|