C16H29N3O4P+ — CID 158171033
2-[[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]oxy-oxophosphaniumyl]oxyethyl-trimethylazanium hydroxide (PubChem CID 158171033) has the molecular formula C16H29N3O4P+ and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]oxy-oxophosphaniumyl]oxyethyl-trimethylazanium hydroxide.
| Compound Name | 2-[[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]oxy-oxophosphaniumyl]oxyethyl-trimethylazanium hydroxide |
|---|---|
| PubChem CID | 158171033 |
| Molecular Formula | C16H29N3O4P+ |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]oxy-oxophosphaniumyl]oxyethyl-trimethylazanium hydroxide |
| SMILES | Cc1cc(N2CCC(O[P+](=O)OCC[N+](C)(C)C)C2)ccc1N.[OH-] |
| InChI | InChI=1S/C16H28N3O3P.H2O/c1-13-11-14(5-6-16(13)17)18-8-7-15(12-18)22-23(20)21-10-9-19(2,3)4;/h5-6,11,15H,7-10,12,17H2,1-4H3;1H2/q+2;/p-1 |
| InChIKey | JAOWSWFKSAWNHF-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|