C12H20N5+ — CID 23132187
[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-(diaminomethylidene)azanium (PubChem CID 23132187) has the molecular formula C12H20N5+ and a molecular weight of 234.33 g/mol. Its IUPAC name is [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-(diaminomethylidene)azanium.
| Compound Name | [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 23132187 |
| Molecular Formula | C12H20N5+ |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-(diaminomethylidene)azanium |
| SMILES | Cc1cc(N2CCC([NH+]=C(N)N)C2)ccc1N |
| InChI | InChI=1S/C12H19N5/c1-8-6-10(2-3-11(8)13)17-5-4-9(7-17)16-12(14)15/h2-3,6,9H,4-5,7,13H2,1H3,(H4,14,15,16)/p+1 |
| InChIKey | YZWSOAULLSKWJF-UHFFFAOYSA-O |
| XLogP | -1.49 |
| TPSA | 95.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|