C16H27Cl2N3 — CID 173073733
2-methyl-4-[3-(1-methylpyrrolidin-1-ium-1-yl)pyrrolidin-1-yl]aniline;chloride;hydrochloride (PubChem CID 173073733) has the molecular formula C16H27Cl2N3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-methyl-4-[3-(1-methylpyrrolidin-1-ium-1-yl)pyrrolidin-1-yl]aniline;chloride;hydrochloride.
| Compound Name | 2-methyl-4-[3-(1-methylpyrrolidin-1-ium-1-yl)pyrrolidin-1-yl]aniline;chloride;hydrochloride |
|---|---|
| PubChem CID | 173073733 |
| Molecular Formula | C16H27Cl2N3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-methyl-4-[3-(1-methylpyrrolidin-1-ium-1-yl)pyrrolidin-1-yl]aniline;chloride;hydrochloride |
| SMILES | Cc1cc(N2CCC([N+]3(C)CCCC3)C2)ccc1N.Cl.[Cl-] |
| InChI | InChI=1S/C16H26N3.2ClH/c1-13-11-14(5-6-16(13)17)18-8-7-15(12-18)19(2)9-3-4-10-19;;/h5-6,11,15H,3-4,7-10,12,17H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | ANOHJBIIZFHMBC-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|