C20H39ClN3S+ — CID 143753052
[1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium;chloromethane (PubChem CID 143753052) has the molecular formula C20H39ClN3S+ and a molecular weight of 389.07 g/mol. Its IUPAC name is [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium;chloromethane.
| Compound Name | [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium;chloromethane |
|---|---|
| PubChem CID | 143753052 |
| Molecular Formula | C20H39ClN3S+ |
| Molecular Weight | 389.07 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [1-(4-amino-3-methylphenyl)pyrrolidin-3-yl]-dimethyl-[3-(trimethyl-λ4-sulfanyl)propyl]azanium;chloromethane |
| SMILES | CCl.Cc1cc(N2CCC([N+](C)(C)CCCS(C)(C)C)C2)ccc1N |
| InChI | InChI=1S/C19H36N3S.CH3Cl/c1-16-14-17(8-9-19(16)20)21-11-10-18(15-21)22(2,3)12-7-13-23(4,5)6;1-2/h8-9,14,18H,7,10-13,15,20H2,1-6H3;1H3/q+1; |
| InChIKey | FSUFGRVIGLNBFZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.07 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|