C28H49ClN6O2+2 — CID 173087851
bis([1-(4-aminophenyl)pyrrolidin-3-yl]-(2-hydroxyethyl)-dimethylazanium);hydrochloride (PubChem CID 173087851) has the molecular formula C28H49ClN6O2+2 and a molecular weight of 537.19 g/mol. Its IUPAC name is bis([1-(4-aminophenyl)pyrrolidin-3-yl]-(2-hydroxyethyl)-dimethylazanium);hydrochloride.
| Compound Name | bis([1-(4-aminophenyl)pyrrolidin-3-yl]-(2-hydroxyethyl)-dimethylazanium);hydrochloride |
|---|---|
| PubChem CID | 173087851 |
| Molecular Formula | C28H49ClN6O2+2 |
| Molecular Weight | 537.19 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | bis([1-(4-aminophenyl)pyrrolidin-3-yl]-(2-hydroxyethyl)-dimethylazanium);hydrochloride |
| SMILES | C[N+](C)(CCO)C1CCN(c2ccc(N)cc2)C1.C[N+](C)(CCO)C1CCN(c2ccc(N)cc2)C1.Cl |
| InChI | InChI=1S/2C14H24N3O.ClH/c2*1-17(2,9-10-18)14-7-8-16(11-14)13-5-3-12(15)4-6-13;/h2*3-6,14,18H,7-11,15H2,1-2H3;1H/q2*+1; |
| InChIKey | ZUOWZHZKQMJTNJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|