C18H33N3O4S — CID 18668002
[1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-propylazanium;propyl sulfate (PubChem CID 18668002) has the molecular formula C18H33N3O4S and a molecular weight of 387.55 g/mol. Its IUPAC name is [1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-propylazanium;propyl sulfate.
| Compound Name | [1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-propylazanium;propyl sulfate |
|---|---|
| PubChem CID | 18668002 |
| Molecular Formula | C18H33N3O4S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [1-(4-aminophenyl)pyrrolidin-3-yl]-dimethyl-propylazanium;propyl sulfate |
| SMILES | CCCOS(=O)(=O)[O-].CCC[N+](C)(C)C1CCN(c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C15H26N3.C3H8O4S/c1-4-11-18(2,3)15-9-10-17(12-15)14-7-5-13(16)6-8-14;1-2-3-7-8(4,5)6/h5-8,15H,4,9-12,16H2,1-3H3;2-3H2,1H3,(H,4,5,6)/q+1;/p-1 |
| InChIKey | BBHNLABKUZHCSO-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|