C34H47N5O2+2 — CID 58150919
[1-[4-[[6-hydroxy-5-methyl-4-oxo-3-[4-[3-(trimethylazaniumyl)pyrrolidin-1-yl]phenyl]iminocyclohexa-1,5-dien-1-yl]methyl]phenyl]pyrrolidin-3-yl]-trimethylazanium (PubChem CID 58150919) has the molecular formula C34H47N5O2+2 and a molecular weight of 557.78 g/mol. Its IUPAC name is [1-[4-[[6-hydroxy-5-methyl-4-oxo-3-[4-[3-(trimethylazaniumyl)pyrrolidin-1-yl]phenyl]iminocyclohexa-1,5-dien-1-yl]methyl]phenyl]pyrrolidin-3-yl]-trimethylazanium.
| Compound Name | [1-[4-[[6-hydroxy-5-methyl-4-oxo-3-[4-[3-(trimethylazaniumyl)pyrrolidin-1-yl]phenyl]iminocyclohexa-1,5-dien-1-yl]methyl]phenyl]pyrrolidin-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 58150919 |
| Molecular Formula | C34H47N5O2+2 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.37 |
| IUPAC Name | [1-[4-[[6-hydroxy-5-methyl-4-oxo-3-[4-[3-(trimethylazaniumyl)pyrrolidin-1-yl]phenyl]iminocyclohexa-1,5-dien-1-yl]methyl]phenyl]pyrrolidin-3-yl]-trimethylazanium |
| SMILES | CC1=C(O)C(Cc2ccc(N3CCC([N+](C)(C)C)C3)cc2)=C/C(=N/c2ccc(N3CCC([N+](C)(C)C)C3)cc2)C1=O |
| InChI | InChI=1S/C34H46N5O2/c1-24-33(40)26(20-25-8-12-28(13-9-25)36-18-16-30(22-36)38(2,3)4)21-32(34(24)41)35-27-10-14-29(15-11-27)37-19-17-31(23-37)39(5,6)7/h8-15,21,30-31H,16-20,22-23H2,1-7H3/q+1/p+1/b35-32- |
| InChIKey | WWWNLLSMPFXAHN-JCUPVDEDSA-O |
| XLogP | 4.91 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'} |
|---|