C30H42N6O2 — CID 70820291
4-[4-[2-(diethylamino)ethylamino]anilino]-6-[4-[2-(diethylamino)ethylamino]phenyl]imino-3-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 70820291) has the molecular formula C30H42N6O2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 4-[4-[2-(diethylamino)ethylamino]anilino]-6-[4-[2-(diethylamino)ethylamino]phenyl]imino-3-hydroxycyclohexa-2,4-dien-1-one.
| Compound Name | 4-[4-[2-(diethylamino)ethylamino]anilino]-6-[4-[2-(diethylamino)ethylamino]phenyl]imino-3-hydroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 70820291 |
| Molecular Formula | C30H42N6O2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | 4-[4-[2-(diethylamino)ethylamino]anilino]-6-[4-[2-(diethylamino)ethylamino]phenyl]imino-3-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | CCN(CC)CCNc1ccc(/N=C2/C=C(Nc3ccc(NCCN(CC)CC)cc3)C(O)=CC2=O)cc1 |
| InChI | InChI=1S/C30H42N6O2/c1-5-35(6-2)19-17-31-23-9-13-25(14-10-23)33-27-21-28(30(38)22-29(27)37)34-26-15-11-24(12-16-26)32-18-20-36(7-3)8-4/h9-16,21-22,31-33,37H,5-8,17-20H2,1-4H3/b34-28- |
| InChIKey | IUTLITJISAKMST-BFYITVNDSA-N |
| XLogP | 5.29 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|