C20H28N4O3 — CID 90987004
4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-one (PubChem CID 90987004) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-one.
| Compound Name | 4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 90987004 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]phenyl]imino-5-imino-2-methylcyclohex-2-en-1-one |
| SMILES | [H]/N=C1\CC(=O)C(C)=C\C1=N/c1ccc(NCCCN(CCO)CCO)cc1 |
| InChI | InChI=1S/C20H28N4O3/c1-15-13-19(18(21)14-20(15)27)23-17-5-3-16(4-6-17)22-7-2-8-24(9-11-25)10-12-26/h3-6,13,21-22,25-26H,2,7-12,14H2,1H3/b21-18+,23-19+ |
| InChIKey | OXRUQHWHUOZGQI-DFFNRHJVSA-N |
| XLogP | 1.79 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|