C19H26N4O4 — CID 90862940
N,N-bis(2-hydroxyethyl)-3-[4-[(6-imino-4-oxocyclohex-2-en-1-ylidene)amino]anilino]propan-1-amine oxide (PubChem CID 90862940) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-[4-[(6-imino-4-oxocyclohex-2-en-1-ylidene)amino]anilino]propan-1-amine oxide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-[4-[(6-imino-4-oxocyclohex-2-en-1-ylidene)amino]anilino]propan-1-amine oxide |
|---|---|
| PubChem CID | 90862940 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-[4-[(6-imino-4-oxocyclohex-2-en-1-ylidene)amino]anilino]propan-1-amine oxide |
| SMILES | [H]/N=C1\CC(=O)C=C\C1=N/c1ccc(NCCC[N+]([O-])(CCO)CCO)cc1 |
| InChI | InChI=1S/C19H26N4O4/c20-18-14-17(26)6-7-19(18)22-16-4-2-15(3-5-16)21-8-1-9-23(27,10-12-24)11-13-25/h2-7,20-21,24-25H,1,8-14H2/b20-18+,22-19+ |
| InChIKey | WODWHPKHPNYQTR-LNELDATLSA-N |
| XLogP | 1.41 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|