C18H22N4O2 — CID 150734561
N,N'-bis(4-nitrosophenyl)hexane-1,6-diamine (PubChem CID 150734561) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N'-bis(4-nitrosophenyl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(4-nitrosophenyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 150734561 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N,N'-bis(4-nitrosophenyl)hexane-1,6-diamine |
| SMILES | O=Nc1ccc(NCCCCCCNc2ccc(N=O)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c23-21-17-9-5-15(6-10-17)19-13-3-1-2-4-14-20-16-7-11-18(22-24)12-8-16/h5-12,19-20H,1-4,13-14H2 |
| InChIKey | JSNZMFAZZUYRLM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|