C18H20N4O3 — CID 89250350
2,6-bis(4-nitrosoanilino)hexanal (PubChem CID 89250350) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2,6-bis(4-nitrosoanilino)hexanal.
| Compound Name | 2,6-bis(4-nitrosoanilino)hexanal |
|---|---|
| PubChem CID | 89250350 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2,6-bis(4-nitrosoanilino)hexanal |
| SMILES | O=CC(CCCCNc1ccc(N=O)cc1)Nc1ccc(N=O)cc1 |
| InChI | InChI=1S/C18H20N4O3/c23-13-18(20-15-6-10-17(22-25)11-7-15)3-1-2-12-19-14-4-8-16(21-24)9-5-14/h4-11,13,18-20H,1-3,12H2 |
| InChIKey | AQLRBMBRKHLBSU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|