C20H30N4 — CID 18622915
1-N-ethyl-4-N-[4-[4-(ethylamino)anilino]butyl]benzene-1,4-diamine (PubChem CID 18622915) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is 1-N-ethyl-4-N-[4-[4-(ethylamino)anilino]butyl]benzene-1,4-diamine.
| Compound Name | 1-N-ethyl-4-N-[4-[4-(ethylamino)anilino]butyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 18622915 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 1-N-ethyl-4-N-[4-[4-(ethylamino)anilino]butyl]benzene-1,4-diamine |
| SMILES | CCNc1ccc(NCCCCNc2ccc(NCC)cc2)cc1 |
| InChI | InChI=1S/C20H30N4/c1-3-21-17-7-11-19(12-8-17)23-15-5-6-16-24-20-13-9-18(10-14-20)22-4-2/h7-14,21-24H,3-6,15-16H2,1-2H3 |
| InChIKey | IYCLYQCIVFUNNA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|